CAS 222541-76-6 appears in our catalog under these names: 4-(5-Methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride, 95%, 4-(5-Methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride (CAS 222541-76-6) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride. InChIKey: SMBDBBBBXFXBSK-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride |
| InChIKey | SMBDBBBBXFXBSK-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)