CAS 138907-80-9 appears in our catalog under these names: 1-(4-Chlorophenyl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(4-Chlorophenyl)-1H-pyrazole-4-carboxylic Acid, 1-(4-Chlorophenyl)pyrazole-4-carboxylic Acid, 98%, 1-(4-Chlorophenyl)-1h-pyrazole-4-carboxylic acid, 98%, 98%, 1-(4-Chlorophenyl)-1h-pyrazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
1-(4-chlorophenyl)pyrazole-4-carboxylic acid (CAS 138907-80-9) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 1-(4-chlorophenyl)pyrazole-4-carboxylic acid. InChIKey: PBSAOBJMSYDULI-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 1-(4-chlorophenyl)pyrazole-4-carboxylic acid |
| InChIKey | PBSAOBJMSYDULI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(C=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)