CAS 112421-33-7 appears in our catalog under these names: Etomidate Impurity 20, Etomidate Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-[(1S)-1-phenylethyl]-2-sulfanylidene-1H-imidazole-4-carboxylate (CAS 112421-33-7) is a chemical compound with the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. IUPAC name: ethyl 3-[(1S)-1-phenylethyl]-2-sulfanylidene-1H-imidazole-4-carboxylate. InChIKey: URUAOABMVSHWSB-JTQLQIEISA-N.
| Molecular formula | C14H16N2O2S |
|---|---|
| Molecular weight | 276.36 g/mol |
| IUPAC name | ethyl 3-[(1S)-1-phenylethyl]-2-sulfanylidene-1H-imidazole-4-carboxylate |
| InChIKey | URUAOABMVSHWSB-JTQLQIEISA-N |
| SMILES | CCOC(=O)C1=CNC(=S)N1[C@@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)