CAS 112521-75-2 is the registry number for 5-(1-Benzofuran-2-yl)-1,3,4-oxadiazole-2-thiol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-(1-benzofuran-2-yl)-3H-1,3,4-oxadiazole-2-thione (CAS 112521-75-2) is a chemical compound with the molecular formula C10H6N2O2S and a molecular weight of 218.23 g/mol. IUPAC name: 5-(1-benzofuran-2-yl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: XTDBHDMLDUGSMY-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O2S |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | 5-(1-benzofuran-2-yl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | XTDBHDMLDUGSMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=NNC(=S)O3 |
Computed by PubChem (NCBI)