CAS 1989672-61-8 is the registry number for Methyl 6-cyano-1,2-benzothiazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 6-cyano-1,2-benzothiazole-3-carboxylate (CAS 1989672-61-8) is a chemical compound with the molecular formula C10H6N2O2S and a molecular weight of 218.23 g/mol. IUPAC name: methyl 6-cyano-1,2-benzothiazole-3-carboxylate. InChIKey: PZHGIWGOOXDKJY-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O2S |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | methyl 6-cyano-1,2-benzothiazole-3-carboxylate |
| InChIKey | PZHGIWGOOXDKJY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NSC2=C1C=CC(=C2)C#N |
Computed by PubChem (NCBI)