CAS 1343081-94-6 is the registry number for 3-(1-Benzofuran-2-yl)-1,2,4-oxadiazole-5-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1-benzofuran-2-yl)-2H-1,2,4-oxadiazole-5-thione (CAS 1343081-94-6) is a chemical compound with the molecular formula C10H6N2O2S and a molecular weight of 218.23 g/mol. IUPAC name: 3-(1-benzofuran-2-yl)-2H-1,2,4-oxadiazole-5-thione. InChIKey: VUNUDJVWRMJHGP-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O2S |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | 3-(1-benzofuran-2-yl)-2H-1,2,4-oxadiazole-5-thione |
| InChIKey | VUNUDJVWRMJHGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=NC(=S)ON3 |
Computed by PubChem (NCBI)