Products 112529-37-0
CAS 112529-37-0 is the registry number for 4-o-Methylepisappanol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 1 mg, 5 mg, 10 mg.
(3R,4R)-3-[(3,4-dihydroxyphenyl)methyl]-4-methoxy-2,4-dihydrochromene-3,7-diol (CAS 112529-37-0) is a chemical compound with the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. IUPAC name: (3R,4R)-3-[(3,4-dihydroxyphenyl)methyl]-4-methoxy-2,4-dihydrochromene-3,7-diol. InChIKey: HHDPKXQKOWHDNA-IAGOWNOFSA-N.
| Molecular formula | C17H18O6 |
|---|---|
| Molecular weight | 318.32 g/mol |
| IUPAC name | (3R,4R)-3-[(3,4-dihydroxyphenyl)methyl]-4-methoxy-2,4-dihydrochromene-3,7-diol |
| InChIKey | HHDPKXQKOWHDNA-IAGOWNOFSA-N |
| SMILES | CO[C@@H]1C2=C(C=C(C=C2)O)OC[C@@]1(CC3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)