Products 215527-72-3
CAS 215527-72-3 appears in our catalog under these names: 4–Aminobiphenyl–2’，3’，4’，5’，6’–d5, 4-Aminobiphenyl-2’,3’,4’,5’,6’-d5. Offered by: GLPBio, Biosynth. Available pack sizes: 10mg, 100mg.
4-(2,3,4,5,6-pentadeuteriophenyl)aniline (CAS 215527-72-3) is a chemical compound with the molecular formula C12H11N and a molecular weight of 174.25 g/mol. IUPAC name: 4-(2,3,4,5,6-pentadeuteriophenyl)aniline. InChIKey: DMVOXQPQNTYEKQ-RALIUCGRSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 174.25 g/mol |
| IUPAC name | 4-(2,3,4,5,6-pentadeuteriophenyl)aniline |
| InChIKey | DMVOXQPQNTYEKQ-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC=C(C=C2)N)[2H])[2H] |
Computed by PubChem (NCBI)