CAS 1126621-86-0 appears in our catalog under these names: Piperazine-d8-n-t-boc, 95%, N-Boc-piperazine-d8, Piperazine-d8-N-t-BOC, 98 atom % D, min 98% Chemical Purity, tert-Butyl piperazine-1-carboxylate-2,2,3,3,5,5,6,6-d8, 99.0%. Offered by: Combi-blocks, TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 0,5g, 0,25g, 0,1g, 250 mg, 100 mg.
Tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate (CAS 1126621-86-0) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 194.30 g/mol. IUPAC name: tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate. InChIKey: CWXPZXBSDSIRCS-DUSUNJSHSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 194.30 g/mol |
| IUPAC name | tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate |
| InChIKey | CWXPZXBSDSIRCS-DUSUNJSHSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C(=O)OC(C)(C)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)