Products 1391054-31-1
CAS 1391054-31-1 appears in our catalog under these names: tert-Butyl piperazine-1-carboxylate-2,3,5,6-13C4, 98%, N-Boc-piperazine-13C4. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Tert-butyl (2,3,5,6-13C4)1,4-diazinane-1-carboxylate (CAS 1391054-31-1) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 190.22 g/mol. IUPAC name: tert-butyl (2,3,5,6-13C4)1,4-diazinane-1-carboxylate. InChIKey: CWXPZXBSDSIRCS-SQLBHGNYSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | tert-butyl (2,3,5,6-13C4)1,4-diazinane-1-carboxylate |
| InChIKey | CWXPZXBSDSIRCS-SQLBHGNYSA-N |
| SMILES | CC(C)(C)OC(=O)N1[13CH2][13CH2]N[13CH2][13CH2]1 |
Computed by PubChem (NCBI)