CAS 118220-98-7 is the registry number for N-Boc-piperazine-2,2,6,6-D4. Offered by: TRC. Available pack sizes: 25mg.
Tert-butyl 2,2,6,6-tetradeuteriopiperazine-1-carboxylate (CAS 118220-98-7) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 190.28 g/mol. IUPAC name: tert-butyl 2,2,6,6-tetradeuteriopiperazine-1-carboxylate. InChIKey: CWXPZXBSDSIRCS-KXGHAPEVSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | tert-butyl 2,2,6,6-tetradeuteriopiperazine-1-carboxylate |
| InChIKey | CWXPZXBSDSIRCS-KXGHAPEVSA-N |
| SMILES | [2H]C1(CNCC(N1C(=O)OC(C)(C)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)