CAS 1126623-20-8 appears in our catalog under these names: Gabapentin-d10, >95% (HPLC), Gabapentin-D10 solution, Gabapentin-d10. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 1ml, 10 mg, 5 mg, 1 mg.
2-[1-(aminomethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]acetic acid (CAS 1126623-20-8) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 181.30 g/mol. IUPAC name: 2-[1-(aminomethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]acetic acid. InChIKey: UGJMXCAKCUNAIE-YXALHFAPSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 181.30 g/mol |
| IUPAC name | 2-[1-(aminomethyl)-2,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexyl]acetic acid |
| InChIKey | UGJMXCAKCUNAIE-YXALHFAPSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])(CC(=O)O)CN)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)