CAS 1185039-20-6 appears in our catalog under these names: Gabapentin-d4, Gabapentin-d4, >95% (HPLC), Gabapentin-d4 (aminomethyl-d2, acetic-d2 acid), 98 atom % D, 16% deuterium incorporation on cyclohexyl ring., min 98% Chemical Purity, Gabapentin-D4, 0.1mg/ml in Methanol, Gabapentin-D4, 1mg/ml in Methanol. Offered by: Chemat Brand, TRC, Lipomed, CDN, GLPBio. Available pack sizes: on request, 10mg, 1mg, 50mg, 100mg, 0,01g, 0,005g, 1ml.
2-[1-[amino(dideuterio)methyl]cyclohexyl]-2,2-dideuterioacetic acid (CAS 1185039-20-6) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 175.26 g/mol. IUPAC name: 2-[1-[amino(dideuterio)methyl]cyclohexyl]-2,2-dideuterioacetic acid. InChIKey: UGJMXCAKCUNAIE-KXGHAPEVSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 175.26 g/mol |
| IUPAC name | 2-[1-[amino(dideuterio)methyl]cyclohexyl]-2,2-dideuterioacetic acid |
| InChIKey | UGJMXCAKCUNAIE-KXGHAPEVSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C1(CCCCC1)C([2H])([2H])N |
Computed by PubChem (NCBI)