CAS 1346600-67-6 is the registry number for Gabapentin-d6. Offered by: TRC. Available pack sizes: 25mg.
2-[1-(aminomethyl)-3,3,4,4,5,5-hexadeuteriocyclohexyl]acetic acid (CAS 1346600-67-6) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 177.27 g/mol. IUPAC name: 2-[1-(aminomethyl)-3,3,4,4,5,5-hexadeuteriocyclohexyl]acetic acid. InChIKey: UGJMXCAKCUNAIE-NMFSSPJFSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 177.27 g/mol |
| IUPAC name | 2-[1-(aminomethyl)-3,3,4,4,5,5-hexadeuteriocyclohexyl]acetic acid |
| InChIKey | UGJMXCAKCUNAIE-NMFSSPJFSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])[2H])([2H])[2H])(CC(=O)O)CN)[2H] |
Computed by PubChem (NCBI)