CAS 1127-35-1 appears in our catalog under these names: Benzo(b)thiophene–3(2H)–one 1,1–Dioxide, Benzo[b]thiophene-3(2H)-one 1,1-Dioxide 97%, Benzo[b]thiophen-3(2H)-one 1,1-dioxide, 97%, 97%, Benzo[b]thiophen-3(2H)-one 1,1-dioxide, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 500mg, 2.5g.
1,1-dioxo-1-benzothiophen-3-one (CAS 1127-35-1) is a chemical compound with the molecular formula C8H6O3S and a molecular weight of 182.20 g/mol. IUPAC name: 1,1-dioxo-1-benzothiophen-3-one. InChIKey: LXCYNALXWGQUIK-UHFFFAOYSA-N.
| Molecular formula | C8H6O3S |
|---|---|
| Molecular weight | 182.20 g/mol |
| IUPAC name | 1,1-dioxo-1-benzothiophen-3-one |
| InChIKey | LXCYNALXWGQUIK-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)