Products 71150-02-2

CAS 71150-02-2 appears in our catalog under these names: (E)-4-Oxo-4-(thiophen-2-yl)but-2-enoic acid 95%, trans-3-(2-Thenoyl)acrylic Acid. Offered by: Ambeed, TRC. Available pack sizes: 50mg, 100mg, 250mg, 1g, 2,5g.

Structural formula: {0} (CAS {1})

(E)-4-oxo-4-thiophen-2-ylbut-2-enoic acid (CAS 71150-02-2) is a chemical compound with the molecular formula C8H6O3S and a molecular weight of 182.20 g/mol. IUPAC name: (E)-4-oxo-4-thiophen-2-ylbut-2-enoic acid. InChIKey: FTZYPJRMSXWPEO-ONEGZZNKSA-N.

Identity
Molecular formulaC8H6O3S
Molecular weight182.20 g/mol
IUPAC name(E)-4-oxo-4-thiophen-2-ylbut-2-enoic acid
InChIKeyFTZYPJRMSXWPEO-ONEGZZNKSA-N
SMILESC1=CSC(=C1)C(=O)/C=C/C(=O)O

Computed by PubChem (NCBI)