CAS 71150-02-2 appears in our catalog under these names: (E)-4-Oxo-4-(thiophen-2-yl)but-2-enoic acid 95%, trans-3-(2-Thenoyl)acrylic Acid. Offered by: Ambeed, TRC. Available pack sizes: 50mg, 100mg, 250mg, 1g, 2,5g.
(E)-4-oxo-4-thiophen-2-ylbut-2-enoic acid (CAS 71150-02-2) is a chemical compound with the molecular formula C8H6O3S and a molecular weight of 182.20 g/mol. IUPAC name: (E)-4-oxo-4-thiophen-2-ylbut-2-enoic acid. InChIKey: FTZYPJRMSXWPEO-ONEGZZNKSA-N.
| Molecular formula | C8H6O3S |
|---|---|
| Molecular weight | 182.20 g/mol |
| IUPAC name | (E)-4-oxo-4-thiophen-2-ylbut-2-enoic acid |
| InChIKey | FTZYPJRMSXWPEO-ONEGZZNKSA-N |
| SMILES | C1=CSC(=C1)C(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)