CAS 2155856-63-4 is the registry number for Dimethyl-1H,3H-thieno(3,4-c)furan-1,3-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,6-dimethylthieno[3,4-c]furan-1,3-dione (CAS 2155856-63-4) is a chemical compound with the molecular formula C8H6O3S and a molecular weight of 182.20 g/mol. IUPAC name: 4,6-dimethylthieno[3,4-c]furan-1,3-dione. InChIKey: OTWYREGVOYREQQ-UHFFFAOYSA-N.
| Molecular formula | C8H6O3S |
|---|---|
| Molecular weight | 182.20 g/mol |
| IUPAC name | 4,6-dimethylthieno[3,4-c]furan-1,3-dione |
| InChIKey | OTWYREGVOYREQQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(S1)C)C(=O)OC2=O |
Computed by PubChem (NCBI)