CAS 112704-82-2 appears in our catalog under these names: Ethyl 3-(3-bromo-4-chlorophenyl)-3-oxopropanoate, 95%, Ethyl 3-(3-bromo-4-chlorophenyl)-3-oxopropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 3-(3-bromo-4-chlorophenyl)-3-oxopropanoate (CAS 112704-82-2) is a chemical compound with the molecular formula C11H10BrClO3 and a molecular weight of 305.55 g/mol. IUPAC name: ethyl 3-(3-bromo-4-chlorophenyl)-3-oxopropanoate. InChIKey: IHOADSQFWLZGMH-UHFFFAOYSA-N.
| Molecular formula | C11H10BrClO3 |
|---|---|
| Molecular weight | 305.55 g/mol |
| IUPAC name | ethyl 3-(3-bromo-4-chlorophenyl)-3-oxopropanoate |
| InChIKey | IHOADSQFWLZGMH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)