CAS 131994-22-4 is the registry number for Ethyl 3-(4-Bromo-2-chlorophenyl)-3-oxopropionate. Offered by: TRC. Available pack sizes: 500mg.
Ethyl 3-(4-bromo-2-chlorophenyl)-3-oxopropanoate (CAS 131994-22-4) is a chemical compound with the molecular formula C11H10BrClO3 and a molecular weight of 305.55 g/mol. IUPAC name: ethyl 3-(4-bromo-2-chlorophenyl)-3-oxopropanoate. InChIKey: KRHXEXDWAMHYNF-UHFFFAOYSA-N.
| Molecular formula | C11H10BrClO3 |
|---|---|
| Molecular weight | 305.55 g/mol |
| IUPAC name | ethyl 3-(4-bromo-2-chlorophenyl)-3-oxopropanoate |
| InChIKey | KRHXEXDWAMHYNF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)