Products 152559-46-1

CAS 152559-46-1 is the registry number for Alpha-bromo-4-chloro-beta-oxo-benzenepropanoic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-bromo-3-(4-chlorophenyl)-3-oxopropanoate (CAS 152559-46-1) is a chemical compound with the molecular formula C11H10BrClO3 and a molecular weight of 305.55 g/mol. IUPAC name: ethyl 2-bromo-3-(4-chlorophenyl)-3-oxopropanoate. InChIKey: VUXGSOOHZPQFNN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10BrClO3
Molecular weight305.55 g/mol
IUPAC nameethyl 2-bromo-3-(4-chlorophenyl)-3-oxopropanoate
InChIKeyVUXGSOOHZPQFNN-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(=O)C1=CC=C(C=C1)Cl)Br

Computed by PubChem (NCBI)