CAS 112793-01-8 is the registry number for N6-(2-Deoxy-D-glucos-2-yl)-L-lysine. Offered by: Chemat. Available pack sizes: 10mg, 1mg, 25mg, 5mg.
(2S)-2-amino-6-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]hexanoic acid (CAS 112793-01-8) is a chemical compound with the molecular formula C12H24N2O7 and a molecular weight of 308.33 g/mol. IUPAC name: (2S)-2-amino-6-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]hexanoic acid. InChIKey: DNMDGVIVITZJJM-FBDQPXRJSA-N.
| Molecular formula | C12H24N2O7 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | (2S)-2-amino-6-[[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]hexanoic acid |
| InChIKey | DNMDGVIVITZJJM-FBDQPXRJSA-N |
| SMILES | C(CCN[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)