Products 96192-34-6
CAS 96192-34-6 appears in our catalog under these names: Alpha-Fructoselysine Dihydrochloride, α–Fructoselysine Dihydrochloride, α-Fructoselysine dihydrochloride, a-Fructoselysine Dihydrochloride, 95%, 95%, N2-(1-Deoxy-D-fructos-1-yl)-L-lysine dihydrochloride, 98%. Offered by: TRC, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5mg, 50mg, 5mg, 10mg, 1mg, 25mg.
(2S)-6-amino-2-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]hexanoic acid (CAS 96192-34-6) is a chemical compound with the molecular formula C12H24N2O7 and a molecular weight of 308.33 g/mol. IUPAC name: (2S)-6-amino-2-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]hexanoic acid. InChIKey: MJTOFLFMNGKVNS-PPNLDZOPSA-N.
| Molecular formula | C12H24N2O7 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | (2S)-6-amino-2-[[(3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]hexanoic acid |
| InChIKey | MJTOFLFMNGKVNS-PPNLDZOPSA-N |
| SMILES | C1[C@H]([C@H]([C@@H](C(O1)(CN[C@@H](CCCCN)C(=O)O)O)O)O)O |
Computed by PubChem (NCBI)