CAS 1143516-05-5 appears in our catalog under these names: 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid, AEEA–AEEA, H-O2Oc-O2Oc-OH, AEEA-AEEA 98%, 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic Acid, 98%, 98%. Offered by: TRC, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 5g, 25g, 100g, 1g, 500g.
2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid (CAS 1143516-05-5) is a chemical compound with the molecular formula C12H24N2O7 and a molecular weight of 308.33 g/mol. IUPAC name: 2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid. InChIKey: YQZVQKYXWPIKIX-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O7 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 2-[2-[2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetic acid |
| InChIKey | YQZVQKYXWPIKIX-UHFFFAOYSA-N |
| SMILES | C(COCCOCC(=O)NCCOCCOCC(=O)O)N |
Computed by PubChem (NCBI)