Products 1128-24-1
CAS 1128-24-1 is the registry number for L-Idonic acid-1,4-lactone. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 50mg, 25mg.
(3R,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one (CAS 1128-24-1) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: (3R,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one. InChIKey: SXZYCXMUPBBULW-NRXMZTRTSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | (3R,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one |
| InChIKey | SXZYCXMUPBBULW-NRXMZTRTSA-N |
| SMILES | C([C@@H]([C@@H]1[C@@H]([C@H](C(=O)O1)O)O)O)O |
Computed by PubChem (NCBI)