Products 1128105-67-8
CAS 1128105-67-8 is the registry number for 3-Amino-1-((4-fluorophenyl)methyl)-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-amino-1-[(4-fluorophenyl)methyl]pyridin-2-one (CAS 1128105-67-8) is a chemical compound with the molecular formula C12H11FN2O and a molecular weight of 218.23 g/mol. IUPAC name: 3-amino-1-[(4-fluorophenyl)methyl]pyridin-2-one. InChIKey: XQRIKLYACYCJLH-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | 3-amino-1-[(4-fluorophenyl)methyl]pyridin-2-one |
| InChIKey | XQRIKLYACYCJLH-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=C1)N)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)