CAS 112811-57-1 appears in our catalog under these names: Gatifloxacin Impurity 5 (3-Desmethyl Gatifloxacin), 3-Desmethyl Gatifloxacin, PD 135042 95%, GATIFLOXACIN RELATED COMPOUND D, 1-Cyclopropyl-6-fluoro-8-methoxy-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid, 95%, 95%. Offered by: Chemat Brand, TRC, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 15MG, 1 g, 25 mg, 50 mg.
1-cyclopropyl-6-fluoro-8-methoxy-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid (CAS 112811-57-1) is a chemical compound with the molecular formula C18H20FN3O4 and a molecular weight of 361.4 g/mol. IUPAC name: 1-cyclopropyl-6-fluoro-8-methoxy-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid. InChIKey: XJCSNIFKGXSDGN-UHFFFAOYSA-N.
| Molecular formula | C18H20FN3O4 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 1-cyclopropyl-6-fluoro-8-methoxy-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid |
| InChIKey | XJCSNIFKGXSDGN-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1N3CCNCC3)F)C(=O)C(=CN2C4CC4)C(=O)O |
Computed by PubChem (NCBI)