CAS 178912-62-4 appears in our catalog under these names: Levofloxacin Impurity 11, Levofloxacin EP Impurity I, Ofloxacin EP Impurity D (S-Isomer) (9-Piperazine Levofloxacin Impurity), 9-Piperazino Levofloxacin Impurity, >95% (HPLC), 9-Piperazino levofloxacin. Offered by: Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: on request, 10mg, 1mg, 5mg, 100mg, 250mg, 500mg, 1000mg.
(2S)-6-fluoro-2-methyl-7-(4-methylpiperazin-1-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (CAS 178912-62-4) is a chemical compound with the molecular formula C18H20FN3O4 and a molecular weight of 361.4 g/mol. IUPAC name: (2S)-6-fluoro-2-methyl-7-(4-methylpiperazin-1-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid. InChIKey: FHAKLRRIGREDDW-JTQLQIEISA-N.
| Molecular formula | C18H20FN3O4 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | (2S)-6-fluoro-2-methyl-7-(4-methylpiperazin-1-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| InChIKey | FHAKLRRIGREDDW-JTQLQIEISA-N |
| SMILES | C[C@H]1COC2=C3N1C=C(C(=O)C3=CC(=C2F)N4CCN(CC4)C)C(=O)O |
Computed by PubChem (NCBI)