Products 1817626-54-2
CAS 1817626-54-2 appears in our catalog under these names: Pf-06650833, 95%, Zimlovisertib/ 98.01% (existing batch purity), PF06650833, Zimlovisertib 97%, Zimlovisertib, 99.94%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 100mg, 250mg, 2mg, 5mg, 10mg, 25mg, 50mg, 1g.
1-[[(2S,3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxyisoquinoline-6-carboxamide (CAS 1817626-54-2) is a chemical compound with the molecular formula C18H20FN3O4 and a molecular weight of 361.4 g/mol. IUPAC name: 1-[[(2S,3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxyisoquinoline-6-carboxamide. InChIKey: JKDGKIBAOAFRPJ-ZBINZKHDSA-N.
| Molecular formula | C18H20FN3O4 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 1-[[(2S,3S,4S)-3-ethyl-4-fluoro-5-oxopyrrolidin-2-yl]methoxy]-7-methoxyisoquinoline-6-carboxamide |
| InChIKey | JKDGKIBAOAFRPJ-ZBINZKHDSA-N |
| SMILES | CC[C@H]1[C@H](NC(=O)[C@H]1F)COC2=NC=CC3=CC(=C(C=C32)OC)C(=O)N |
Computed by PubChem (NCBI)