CAS 112898-42-7 is the registry number for Imipramine-d3 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 1 mg.
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine (CAS 112898-42-7) is a chemical compound with the molecular formula C19H24N2 and a molecular weight of 283.4 g/mol. IUPAC name: 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine. InChIKey: BCGWQEUPMDMJNV-FIBGUPNXSA-N.
| Molecular formula | C19H24N2 |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methyl-N-(trideuteriomethyl)propan-1-amine |
| InChIKey | BCGWQEUPMDMJNV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(C)CCCN1C2=CC=CC=C2CCC3=CC=CC=C31 |
Computed by PubChem (NCBI)