CAS 112924-95-5 is the registry number for (11-cis,13-cis)-4-Oxoretinoic Acid. Offered by: TRC. Available pack sizes: 25mg.
(2Z,4Z,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid (CAS 112924-95-5) is a chemical compound with the molecular formula C20H26O3 and a molecular weight of 314.4 g/mol. IUPAC name: (2Z,4Z,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid. InChIKey: GGCUJPCCTQNTJF-PZDNLKTBSA-N.
| Molecular formula | C20H26O3 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (2Z,4Z,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid |
| InChIKey | GGCUJPCCTQNTJF-PZDNLKTBSA-N |
| SMILES | CC1=C(C(CCC1=O)(C)C)/C=C/C(=C/C=C\C(=C/C(=O)O)\C)/C |
Computed by PubChem (NCBI)