CAS 1185241-31-9 appears in our catalog under these names: 4-Keto 9-cis Retinoic Acid-d3, 4-Keto 13-cis-Retinoic Acid-d3. Offered by: TRC. Available pack sizes: 25mg, 0,5mg, 1mg, 5mg.
(2Z,4E,6E,8E)-9-[6,6-dimethyl-3-oxo-2-(trideuteriomethyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid (CAS 1185241-31-9) is a chemical compound with the molecular formula C20H26O3 and a molecular weight of 317.4 g/mol. IUPAC name: (2Z,4E,6E,8E)-9-[6,6-dimethyl-3-oxo-2-(trideuteriomethyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid. InChIKey: GGCUJPCCTQNTJF-CPIFKUAWSA-N.
| Molecular formula | C20H26O3 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | (2Z,4E,6E,8E)-9-[6,6-dimethyl-3-oxo-2-(trideuteriomethyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| InChIKey | GGCUJPCCTQNTJF-CPIFKUAWSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(CCC1=O)(C)C)/C=C/C(=C/C=C/C(=C\C(=O)O)/C)/C |
Computed by PubChem (NCBI)