Products 112953-12-5
CAS 112953-12-5 is the registry number for 6-Deoxyilludin M. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5R)-5-hydroxy-2,2,5,7-tetramethylspiro[1H-indene-6,1'-cyclopropane]-4-one (CAS 112953-12-5) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: (5R)-5-hydroxy-2,2,5,7-tetramethylspiro[1H-indene-6,1'-cyclopropane]-4-one. InChIKey: YHXLWSXPTJEXBW-AWEZNQCLSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (5R)-5-hydroxy-2,2,5,7-tetramethylspiro[1H-indene-6,1'-cyclopropane]-4-one |
| InChIKey | YHXLWSXPTJEXBW-AWEZNQCLSA-N |
| SMILES | CC1=C2CC(C=C2C(=O)[C@](C13CC3)(C)O)(C)C |
Computed by PubChem (NCBI)