CAS 1130072-57-9 is the registry number for Iclaprim-d6. Offered by: Hubei YoungXin, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg, 25 mg, 1 mg.
5-[[2-cyclopropyl-7,8-bis(trideuteriomethoxy)-2H-chromen-5-yl]methyl]pyrimidine-2,4-diamine (CAS 1130072-57-9) is a chemical compound with the molecular formula C19H22N4O3 and a molecular weight of 360.4 g/mol. IUPAC name: 5-[[2-cyclopropyl-7,8-bis(trideuteriomethoxy)-2H-chromen-5-yl]methyl]pyrimidine-2,4-diamine. InChIKey: HWJPWWYTGBZDEG-WFGJKAKNSA-N.
| Molecular formula | C19H22N4O3 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 5-[[2-cyclopropyl-7,8-bis(trideuteriomethoxy)-2H-chromen-5-yl]methyl]pyrimidine-2,4-diamine |
| InChIKey | HWJPWWYTGBZDEG-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C2=C(C=CC(O2)C3CC3)C(=C1)CC4=CN=C(N=C4N)N)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)