CAS 862894-96-0 appears in our catalog under these names: Bortezomib Impurity O, Bortezomib Impurity 3, Bortezomib Impurity 4, Bortezomib Impurity 28, (S)-N-(1-(3-Methylbutanamido)-1-oxo-3-phenylpropan-2-yl)pyrazine-2-carboxamide, 95+%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 5mg.
N-[(2S)-1-(3-methylbutanoylamino)-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide (CAS 862894-96-0) is a chemical compound with the molecular formula C19H22N4O3 and a molecular weight of 354.4 g/mol. IUPAC name: N-[(2S)-1-(3-methylbutanoylamino)-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide. InChIKey: WREPYMVPDVCLPX-HNNXBMFYSA-N.
| Molecular formula | C19H22N4O3 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | N-[(2S)-1-(3-methylbutanoylamino)-1-oxo-3-phenylpropan-2-yl]pyrazine-2-carboxamide |
| InChIKey | WREPYMVPDVCLPX-HNNXBMFYSA-N |
| SMILES | CC(C)CC(=O)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2 |
Computed by PubChem (NCBI)