Products 155271-17-3
CAS 155271-17-3 is the registry number for KF21213. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, 50mg, 25mg, Get quote.
8-[(E)-2-(4-methoxy-2,3-dimethylphenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione (CAS 155271-17-3) is a chemical compound with the molecular formula C19H22N4O3 and a molecular weight of 354.4 g/mol. IUPAC name: 8-[(E)-2-(4-methoxy-2,3-dimethylphenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione. InChIKey: SDHWMROLJYZHCX-CSKARUKUSA-N.
| Molecular formula | C19H22N4O3 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 8-[(E)-2-(4-methoxy-2,3-dimethylphenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione |
| InChIKey | SDHWMROLJYZHCX-CSKARUKUSA-N |
| SMILES | CC1=C(C=CC(=C1C)OC)/C=C/C2=NC3=C(N2C)C(=O)N(C(=O)N3C)C |
Computed by PubChem (NCBI)