Products 1130344-76-1
CAS 1130344-76-1 appears in our catalog under these names: Methyl 2,6-dichloro-4-(trifluoromethyl)nicotinate, 95%, 95%, Methyl 2,6-dichloro-4-(trifluoromethyl)nicotinate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2,6-dichloro-4-(trifluoromethyl)pyridine-3-carboxylate (CAS 1130344-76-1) is a chemical compound with the molecular formula C8H4Cl2F3NO2 and a molecular weight of 274.02 g/mol. IUPAC name: methyl 2,6-dichloro-4-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: IYTYTJDDVIXLFF-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F3NO2 |
|---|---|
| Molecular weight | 274.02 g/mol |
| IUPAC name | methyl 2,6-dichloro-4-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | IYTYTJDDVIXLFF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(C=C1C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)