Products 122947-76-6
CAS 122947-76-6 is the registry number for 1-(Dichloromethyl)-2-nitro-4-(trifluoromethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(dichloromethyl)-2-nitro-4-(trifluoromethyl)benzene (CAS 122947-76-6) is a chemical compound with the molecular formula C8H4Cl2F3NO2 and a molecular weight of 274.02 g/mol. IUPAC name: 1-(dichloromethyl)-2-nitro-4-(trifluoromethyl)benzene. InChIKey: NCWHNUFWTDSEFS-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F3NO2 |
|---|---|
| Molecular weight | 274.02 g/mol |
| IUPAC name | 1-(dichloromethyl)-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | NCWHNUFWTDSEFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])C(Cl)Cl |
Computed by PubChem (NCBI)