CAS 2761296-98-2 is the registry number for Methyl 3,6-dichloro-5-(trifluoromethyl)picolinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3,6-dichloro-5-(trifluoromethyl)pyridine-2-carboxylate (CAS 2761296-98-2) is a chemical compound with the molecular formula C8H4Cl2F3NO2 and a molecular weight of 274.02 g/mol. IUPAC name: methyl 3,6-dichloro-5-(trifluoromethyl)pyridine-2-carboxylate. InChIKey: KDXSDKATBQEVAR-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F3NO2 |
|---|---|
| Molecular weight | 274.02 g/mol |
| IUPAC name | methyl 3,6-dichloro-5-(trifluoromethyl)pyridine-2-carboxylate |
| InChIKey | KDXSDKATBQEVAR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=N1)Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)