CAS 1131580-14-7 is the registry number for 6-(3-Fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
6-(3-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid (CAS 1131580-14-7) is a chemical compound with the molecular formula C13H9FN2O2S and a molecular weight of 276.29 g/mol. IUPAC name: 6-(3-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid. InChIKey: QOFUXNKSTDPVSX-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O2S |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 6-(3-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| InChIKey | QOFUXNKSTDPVSX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC(=CN12)C3=CC(=CC=C3)F)C(=O)O |
Computed by PubChem (NCBI)