CAS 951908-85-3 is the registry number for 6-(4-Fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 250mg, 1g, 5g.
6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid (CAS 951908-85-3) is a chemical compound with the molecular formula C13H9FN2O2S and a molecular weight of 276.29 g/mol. IUPAC name: 6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid. InChIKey: SMQPIXKMFXXTGG-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O2S |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
| InChIKey | SMQPIXKMFXXTGG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC(=CN12)C3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)