CAS 1232807-82-7 appears in our catalog under these names: 3-[(4-Fluorophenyl)methyl]-1H,2H,3H,4H-thieno[3,2-d]pyrimidine-2,4-dione, 98%, 98%, 3-(4-Fluorobenzyl)thieno[3,2-d]pyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 1g.
3-[(4-fluorophenyl)methyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione (CAS 1232807-82-7) is a chemical compound with the molecular formula C13H9FN2O2S and a molecular weight of 276.29 g/mol. IUPAC name: 3-[(4-fluorophenyl)methyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione. InChIKey: IACLXQVNJWIODY-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O2S |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)methyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| InChIKey | IACLXQVNJWIODY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C(=O)C3=C(C=CS3)NC2=O)F |
Computed by PubChem (NCBI)