CAS 1131613-58-5 is the registry number for 6-Ethyl-2-methylimidazo(2,1-b)thiazole-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-ethyl-2-methylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid (CAS 1131613-58-5) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 6-ethyl-2-methylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid. InChIKey: CQYBCFIZGICZEB-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 6-ethyl-2-methylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid |
| InChIKey | CQYBCFIZGICZEB-UHFFFAOYSA-N |
| SMILES | CCC1=C(N2C=C(SC2=N1)C)C(=O)O |
Computed by PubChem (NCBI)