CAS 1132667-04-9 appears in our catalog under these names: Ivabradine Impurity 3, Ivabradine Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(7R)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]-N-methylmethanamine (CAS 1132667-04-9) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: 1-[(7R)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]-N-methylmethanamine. InChIKey: SAVVFXUMMFHSJC-VIFPVBQESA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 1-[(7R)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]-N-methylmethanamine |
| InChIKey | SAVVFXUMMFHSJC-VIFPVBQESA-N |
| SMILES | CNC[C@@H]1CC2=CC(=C(C=C12)OC)OC |
Computed by PubChem (NCBI)