Products 866783-12-2

CAS 866783-12-2 is the registry number for Ivabradine USP RC Ivabradine Amine. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-[(7S)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]-N-methylmethanamine (CAS 866783-12-2) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: 1-[(7S)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]-N-methylmethanamine. InChIKey: SAVVFXUMMFHSJC-SECBINFHSA-N.

Identity
Molecular formulaC12H17NO2
Molecular weight207.27 g/mol
IUPAC name1-[(7S)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]-N-methylmethanamine
InChIKeySAVVFXUMMFHSJC-SECBINFHSA-N
SMILESCNC[C@H]1CC2=CC(=C(C=C12)OC)OC

Computed by PubChem (NCBI)