CAS 1132669-74-9 appears in our catalog under these names: (E)-2-(2-Ethoxycarbonylvinyl)phenylboronic acid, pinacol ester, 95%, 95%, (E)-Ethyl 3-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acrylate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl (E)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate (CAS 1132669-74-9) is a chemical compound with the molecular formula C17H23BO4 and a molecular weight of 302.2 g/mol. IUPAC name: ethyl (E)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate. InChIKey: GKWJVFYWVQLYNW-VAWYXSNFSA-N.
| Molecular formula | C17H23BO4 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | ethyl (E)-3-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enoate |
| InChIKey | GKWJVFYWVQLYNW-VAWYXSNFSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2/C=C/C(=O)OCC |
Computed by PubChem (NCBI)