CAS 1259022-88-2 is the registry number for 4-[(1-Methoxycarbonyl)cyclopropyl]phenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate (CAS 1259022-88-2) is a chemical compound with the molecular formula C17H23BO4 and a molecular weight of 302.2 g/mol. IUPAC name: methyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate. InChIKey: XQQDYMOXTLWTIM-UHFFFAOYSA-N.
| Molecular formula | C17H23BO4 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | methyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate |
| InChIKey | XQQDYMOXTLWTIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(CC3)C(=O)OC |
Computed by PubChem (NCBI)