CAS 2851113-42-1 is the registry number for Benzyl (E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate (CAS 2851113-42-1) is a chemical compound with the molecular formula C17H23BO4 and a molecular weight of 302.2 g/mol. IUPAC name: benzyl (E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate. InChIKey: FQFAYLCKFJDZIJ-QBFSEMIESA-N.
| Molecular formula | C17H23BO4 |
|---|---|
| Molecular weight | 302.2 g/mol |
| IUPAC name | benzyl (E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enoate |
| InChIKey | FQFAYLCKFJDZIJ-QBFSEMIESA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C(=C\C(=O)OCC2=CC=CC=C2)/C |
Computed by PubChem (NCBI)