CAS 1132940-86-3 is the registry number for N–(6–BroMo–naphthalen–2–yl)MethanesulfonaMide. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 5g.
N-(6-bromonaphthalen-2-yl)methanesulfonamide (CAS 1132940-86-3) is a chemical compound with the molecular formula C11H10BrNO2S and a molecular weight of 300.17 g/mol. IUPAC name: N-(6-bromonaphthalen-2-yl)methanesulfonamide. InChIKey: CFCFBYXYRVYAPU-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2S |
|---|---|
| Molecular weight | 300.17 g/mol |
| IUPAC name | N-(6-bromonaphthalen-2-yl)methanesulfonamide |
| InChIKey | CFCFBYXYRVYAPU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)