Products 2891985-92-3
CAS 2891985-92-3 is the registry number for 2-(4-Bromo-3-methoxyphenyl)-5-methylthiazol-4-ol, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
2-(4-bromo-3-methoxyphenyl)-5-methyl-1,3-thiazol-4-ol (CAS 2891985-92-3) is a chemical compound with the molecular formula C11H10BrNO2S and a molecular weight of 300.17 g/mol. IUPAC name: 2-(4-bromo-3-methoxyphenyl)-5-methyl-1,3-thiazol-4-ol. InChIKey: VCBJORZJWACZEO-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2S |
|---|---|
| Molecular weight | 300.17 g/mol |
| IUPAC name | 2-(4-bromo-3-methoxyphenyl)-5-methyl-1,3-thiazol-4-ol |
| InChIKey | VCBJORZJWACZEO-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C2=CC(=C(C=C2)Br)OC)O |
Computed by PubChem (NCBI)