CAS 791614-78-3 is the registry number for Ethyl 2-(6-bromobenzo(d)thiazol-2-yl)acetate, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 2-(6-bromo-1,3-benzothiazol-2-yl)acetate (CAS 791614-78-3) is a chemical compound with the molecular formula C11H10BrNO2S and a molecular weight of 300.17 g/mol. IUPAC name: ethyl 2-(6-bromo-1,3-benzothiazol-2-yl)acetate. InChIKey: NRVKXPLEMJKYKS-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO2S |
|---|---|
| Molecular weight | 300.17 g/mol |
| IUPAC name | ethyl 2-(6-bromo-1,3-benzothiazol-2-yl)acetate |
| InChIKey | NRVKXPLEMJKYKS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NC2=C(S1)C=C(C=C2)Br |
Computed by PubChem (NCBI)